C24H22N6O4 — CID 46696830
[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate (PubChem CID 46696830) has the molecular formula C24H22N6O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate.
| Compound Name | [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 46696830 |
| Molecular Formula | C24H22N6O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl] 3-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)propanoate |
| SMILES | Cn1ncc2c(=O)n(CCC(=O)OCC(=O)NN=C(c3ccccc3)c3ccccc3)cnc21 |
| InChI | InChI=1S/C24H22N6O4/c1-29-23-19(14-26-29)24(33)30(16-25-23)13-12-21(32)34-15-20(31)27-28-22(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,14,16H,12-13,15H2,1H3,(H,27,31) |
| InChIKey | YAIIPRVOXRMRON-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|