C25H30N6O2S — CID 46699417
N-methyl-3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N-[(4-piperidin-1-ylphenyl)methyl]benzamide (PubChem CID 46699417) has the molecular formula C25H30N6O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-methyl-3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N-[(4-piperidin-1-ylphenyl)methyl]benzamide.
| Compound Name | N-methyl-3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N-[(4-piperidin-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46699417 |
| Molecular Formula | C25H30N6O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-methyl-3-[[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-N-[(4-piperidin-1-ylphenyl)methyl]benzamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)c1cccc(NC(=O)CSc2nncn2C)c1 |
| InChI | InChI=1S/C25H30N6O2S/c1-29(16-19-9-11-22(12-10-19)31-13-4-3-5-14-31)24(33)20-7-6-8-21(15-20)27-23(32)17-34-25-28-26-18-30(25)2/h6-12,15,18H,3-5,13-14,16-17H2,1-2H3,(H,27,32) |
| InChIKey | XVFLETYKCKLVIR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|