C24H31N3O6S — CID 46701029
butyl 4-[6-(4-cyclopropylsulfonylphenoxy)-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 46701029) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is butyl 4-[6-(4-cyclopropylsulfonylphenoxy)-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | butyl 4-[6-(4-cyclopropylsulfonylphenoxy)-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 46701029 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | butyl 4-[6-(4-cyclopropylsulfonylphenoxy)-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(Oc2ncnc(Oc3ccc(S(=O)(=O)C4CC4)cc3)c2C)CC1 |
| InChI | InChI=1S/C24H31N3O6S/c1-3-4-15-31-24(28)27-13-11-19(12-14-27)33-23-17(2)22(25-16-26-23)32-18-5-7-20(8-6-18)34(29,30)21-9-10-21/h5-8,16,19,21H,3-4,9-15H2,1-2H3 |
| InChIKey | JGIIIXSFYZPSKR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|