C25H23F6N3O5S — CID 46701538
2-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]methyl]triazol-4-yl]methoxycarbonyl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 46701538) has the molecular formula C25H23F6N3O5S and a molecular weight of 591.53 g/mol. Its IUPAC name is 2-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]methyl]triazol-4-yl]methoxycarbonyl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]methyl]triazol-4-yl]methoxycarbonyl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 46701538 |
| Molecular Formula | C25H23F6N3O5S |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | 2-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)phenyl]methyl]triazol-4-yl]methoxycarbonyl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | COC(c1ccc(Cn2cc(COC(=O)c3ccc(SC(C)(C)C(=O)O)cc3)nn2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H23F6N3O5S/c1-22(2,21(36)37)40-19-10-6-16(7-11-19)20(35)39-14-18-13-34(33-32-18)12-15-4-8-17(9-5-15)23(38-3,24(26,27)28)25(29,30)31/h4-11,13H,12,14H2,1-3H3,(H,36,37) |
| InChIKey | JTACKOKVCYDNLD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |