C27H49NO3Si — CID 46702055
(3R)-3-[(2R,3S,5S,6S)-2,5-dimethyl-2-prop-2-enyl-6-[3-tri(propan-2-yl)silyloxypropyl]oxan-3-yl]oxypent-4-enenitrile (PubChem CID 46702055) has the molecular formula C27H49NO3Si and a molecular weight of 463.78 g/mol. Its IUPAC name is (3R)-3-[(2R,3S,5S,6S)-2,5-dimethyl-2-prop-2-enyl-6-[3-tri(propan-2-yl)silyloxypropyl]oxan-3-yl]oxypent-4-enenitrile.
| Compound Name | (3R)-3-[(2R,3S,5S,6S)-2,5-dimethyl-2-prop-2-enyl-6-[3-tri(propan-2-yl)silyloxypropyl]oxan-3-yl]oxypent-4-enenitrile |
|---|---|
| PubChem CID | 46702055 |
| Molecular Formula | C27H49NO3Si |
| Molecular Weight | 463.78 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | (3R)-3-[(2R,3S,5S,6S)-2,5-dimethyl-2-prop-2-enyl-6-[3-tri(propan-2-yl)silyloxypropyl]oxan-3-yl]oxypent-4-enenitrile |
| SMILES | C=CC[C@@]1(C)O[C@@H](CCCO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C[C@@H]1O[C@@H](C=C)CC#N |
| InChI | InChI=1S/C27H49NO3Si/c1-11-16-27(10)26(30-24(12-2)15-17-28)19-23(9)25(31-27)14-13-18-29-32(20(3)4,21(5)6)22(7)8/h11-12,20-26H,1-2,13-16,18-19H2,3-10H3/t23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | ATBVNXWRANLSIQ-JSLVBRCRSA-N |
| XLogP | 7.57 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|