C12H16Cl2O4 — CID 46702474
[(1S,6R)-6-(2,2-dichloroacetyl)oxycyclohex-3-en-1-yl] 2-methylpropanoate (PubChem CID 46702474) has the molecular formula C12H16Cl2O4 and a molecular weight of 295.16 g/mol. Its IUPAC name is [(1S,6R)-6-(2,2-dichloroacetyl)oxycyclohex-3-en-1-yl] 2-methylpropanoate.
| Compound Name | [(1S,6R)-6-(2,2-dichloroacetyl)oxycyclohex-3-en-1-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 46702474 |
| Molecular Formula | C12H16Cl2O4 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | [(1S,6R)-6-(2,2-dichloroacetyl)oxycyclohex-3-en-1-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1CC=CC[C@H]1OC(=O)C(Cl)Cl |
| InChI | InChI=1S/C12H16Cl2O4/c1-7(2)11(15)17-8-5-3-4-6-9(8)18-12(16)10(13)14/h3-4,7-10H,5-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | OPIJOKWOHNMHHD-DTWKUNHWSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|