C20H22ClN3O2S — CID 46703966
4-chloro-1-N-cyclohexyl-2-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]benzene-1,2-dicarboxamide (PubChem CID 46703966) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 4-chloro-1-N-cyclohexyl-2-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]benzene-1,2-dicarboxamide.
| Compound Name | 4-chloro-1-N-cyclohexyl-2-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 46703966 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-chloro-1-N-cyclohexyl-2-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]benzene-1,2-dicarboxamide |
| SMILES | Cc1ccsc1/C=N/NC(=O)c1cc(Cl)ccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-13-9-10-27-18(13)12-22-24-20(26)17-11-14(21)7-8-16(17)19(25)23-15-5-3-2-4-6-15/h7-12,15H,2-6H2,1H3,(H,23,25)(H,24,26)/b22-12+ |
| InChIKey | NBRCKRQTRLONFI-WSDLNYQXSA-N |
| XLogP | 4.54 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|