C13H10ClN3O3S — CID 6896329
2-chloro-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-4-nitrobenzamide (PubChem CID 6896329) has the molecular formula C13H10ClN3O3S and a molecular weight of 323.76 g/mol. Its IUPAC name is 2-chloro-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 6896329 |
| Molecular Formula | C13H10ClN3O3S |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-chloro-N-[(E)-(3-methylthiophen-2-yl)methylideneamino]-4-nitrobenzamide |
| SMILES | Cc1ccsc1/C=N/NC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C13H10ClN3O3S/c1-8-4-5-21-12(8)7-15-16-13(18)10-3-2-9(17(19)20)6-11(10)14/h2-7H,1H3,(H,16,18)/b15-7+ |
| InChIKey | XPRVUIOOMARIBZ-VIZOYTHASA-N |
| XLogP | 3.38 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|