C23H19NO5 — CID 46704186
(2S,3R)-7-ethoxy-2-(3-nitrophenyl)-3-phenyl-2,3-dihydrochromen-4-one (PubChem CID 46704186) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2S,3R)-7-ethoxy-2-(3-nitrophenyl)-3-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3R)-7-ethoxy-2-(3-nitrophenyl)-3-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 46704186 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (2S,3R)-7-ethoxy-2-(3-nitrophenyl)-3-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CCOc1ccc2c(c1)O[C@H](c1cccc([N+](=O)[O-])c1)[C@@H](c1ccccc1)C2=O |
| InChI | InChI=1S/C23H19NO5/c1-2-28-18-11-12-19-20(14-18)29-23(16-9-6-10-17(13-16)24(26)27)21(22(19)25)15-7-4-3-5-8-15/h3-14,21,23H,2H2,1H3/t21-,23+/m0/s1 |
| InChIKey | QZMUBRYEMQHARZ-JTHBVZDNSA-N |
| XLogP | 5.09 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|