C15H14BrNO3 — CID 46705399
[2-amino-3-(2,2-dihydroxyethyl)phenyl]-(4-bromophenyl)methanone (PubChem CID 46705399) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is [2-amino-3-(2,2-dihydroxyethyl)phenyl]-(4-bromophenyl)methanone.
| Compound Name | [2-amino-3-(2,2-dihydroxyethyl)phenyl]-(4-bromophenyl)methanone |
|---|---|
| PubChem CID | 46705399 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | [2-amino-3-(2,2-dihydroxyethyl)phenyl]-(4-bromophenyl)methanone |
| SMILES | Nc1c(CC(O)O)cccc1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7,13,18-19H,8,17H2 |
| InChIKey | SZUMIJIQSQFYKI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|