C34H41BrN2O8 — CID 89155196
2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;[2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 89155196) has the molecular formula C34H41BrN2O8 and a molecular weight of 685.61 g/mol. Its IUPAC name is 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;[2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;[2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89155196 |
| Molecular Formula | C34H41BrN2O8 |
| Molecular Weight | 685.61 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | 2-[2-amino-3-(4-bromobenzoyl)phenyl]acetic acid;[2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CNCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1.Nc1c(CC(=O)O)cccc1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H29NO5.C15H12BrNO3/c1-18(2,3)16(22)24-14-9-8-12(13(21)11-20-7)10-15(14)25-17(23)19(4,5)6;16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h8-10,13,20-21H,11H2,1-7H3;1-7H,8,17H2,(H,18,19) |
| InChIKey | OQHZTSFJANWELT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 165.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|