C12H20N4O2S2 — CID 4671405
ethenyl N-[2-(piperidine-1-carbothioylamino)ethylcarbamothioyl]carbamate (PubChem CID 4671405) has the molecular formula C12H20N4O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is ethenyl N-[2-(piperidine-1-carbothioylamino)ethylcarbamothioyl]carbamate.
| Compound Name | ethenyl N-[2-(piperidine-1-carbothioylamino)ethylcarbamothioyl]carbamate |
|---|---|
| PubChem CID | 4671405 |
| Molecular Formula | C12H20N4O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | ethenyl N-[2-(piperidine-1-carbothioylamino)ethylcarbamothioyl]carbamate |
| SMILES | C=COC(=O)NC(=S)NCCNC(=S)N1CCCCC1 |
| InChI | InChI=1S/C12H20N4O2S2/c1-2-18-12(17)15-10(19)13-6-7-14-11(20)16-8-4-3-5-9-16/h2H,1,3-9H2,(H,14,20)(H2,13,15,17,19) |
| InChIKey | YZQQQPOQAIWGKE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|