C13H26N4O2S — CID 84557436
tert-butyl N-[2-(1,4-diazepane-1-carbothioylamino)ethyl]carbamate (PubChem CID 84557436) has the molecular formula C13H26N4O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is tert-butyl N-[2-(1,4-diazepane-1-carbothioylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,4-diazepane-1-carbothioylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 84557436 |
| Molecular Formula | C13H26N4O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | tert-butyl N-[2-(1,4-diazepane-1-carbothioylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=S)N1CCCNCC1 |
| InChI | InChI=1S/C13H26N4O2S/c1-13(2,3)19-12(18)16-7-6-15-11(20)17-9-4-5-14-8-10-17/h14H,4-10H2,1-3H3,(H,15,20)(H,16,18) |
| InChIKey | FRQOOSKGBIMKOM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|