C20H27N5O4 — CID 4672453
6-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]hexylurea (PubChem CID 4672453) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 6-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]hexylurea.
| Compound Name | 6-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]hexylurea |
|---|---|
| PubChem CID | 4672453 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 6-[5-[[4-(dimethylamino)phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]hexylurea |
| SMILES | CN(C)c1ccc(C=C2C(=O)NC(=O)N(CCCCCCNC(N)=O)C2=O)cc1 |
| InChI | InChI=1S/C20H27N5O4/c1-24(2)15-9-7-14(8-10-15)13-16-17(26)23-20(29)25(18(16)27)12-6-4-3-5-11-22-19(21)28/h7-10,13H,3-6,11-12H2,1-2H3,(H3,21,22,28)(H,23,26,29) |
| InChIKey | HNDVNEIPSCOXDS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|