C15H16N4O3S — CID 3738146
2-[[5-[[4-(dimethylamino)phenyl]methylidene]-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 3738146) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-[[5-[[4-(dimethylamino)phenyl]methylidene]-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-[[4-(dimethylamino)phenyl]methylidene]-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3738146 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[[5-[[4-(dimethylamino)phenyl]methylidene]-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | CN(C)c1ccc(C=C2C(=O)N=C(SCC(N)=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H16N4O3S/c1-19(2)10-5-3-9(4-6-10)7-11-13(21)17-15(18-14(11)22)23-8-12(16)20/h3-7H,8H2,1-2H3,(H2,16,20)(H,17,18,21,22) |
| InChIKey | LXORSCNNZHEYSE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|