C13H17N5OS — CID 3228167
2-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3228167) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | 2-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3228167 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(N)=O)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H17N5OS/c1-9-15-16-13(20-8-12(14)19)18(9)11-6-4-10(5-7-11)17(2)3/h4-7H,8H2,1-3H3,(H2,14,19) |
| InChIKey | XAKNFBBWASSJPR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|