C14H18N4OS — CID 3228148
1-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]propan-2-one (PubChem CID 3228148) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]propan-2-one.
| Compound Name | 1-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]propan-2-one |
|---|---|
| PubChem CID | 3228148 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[[4-[4-(dimethylamino)phenyl]-5-methyl-1,2,4-triazol-3-yl]sulfanyl]propan-2-one |
| SMILES | CC(=O)CSc1nnc(C)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H18N4OS/c1-10(19)9-20-14-16-15-11(2)18(14)13-7-5-12(6-8-13)17(3)4/h5-8H,9H2,1-4H3 |
| InChIKey | MTCKTNPIIXCDQZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|