C18H19Cl2NO2 — CID 46736285
N-[(3,5-dichlorophenyl)methyl]-4-(oxolan-2-ylmethoxy)aniline (PubChem CID 46736285) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-4-(oxolan-2-ylmethoxy)aniline.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-4-(oxolan-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 46736285 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-4-(oxolan-2-ylmethoxy)aniline |
| SMILES | Clc1cc(Cl)cc(CNc2ccc(OCC3CCCO3)cc2)c1 |
| InChI | InChI=1S/C18H19Cl2NO2/c19-14-8-13(9-15(20)10-14)11-21-16-3-5-17(6-4-16)23-12-18-2-1-7-22-18/h3-6,8-10,18,21H,1-2,7,11-12H2 |
| InChIKey | DACXPKOCFYTQRY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|