C12H17BN2O3 — CID 46739539
[2-[(dimethylamino)methyl]-5-(prop-2-enoylamino)phenyl]boronic acid (PubChem CID 46739539) has the molecular formula C12H17BN2O3 and a molecular weight of 248.09 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-5-(prop-2-enoylamino)phenyl]boronic acid.
| Compound Name | [2-[(dimethylamino)methyl]-5-(prop-2-enoylamino)phenyl]boronic acid |
|---|---|
| PubChem CID | 46739539 |
| Molecular Formula | C12H17BN2O3 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | [2-[(dimethylamino)methyl]-5-(prop-2-enoylamino)phenyl]boronic acid |
| SMILES | C=CC(=O)Nc1ccc(CN(C)C)c(B(O)O)c1 |
| InChI | InChI=1S/C12H17BN2O3/c1-4-12(16)14-10-6-5-9(8-15(2)3)11(7-10)13(17)18/h4-7,17-18H,1,8H2,2-3H3,(H,14,16) |
| InChIKey | RNZSJWFUMIMTKK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|