C18H22BNO3 — CID 46739747
N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (PubChem CID 46739747) has the molecular formula C18H22BNO3 and a molecular weight of 311.19 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine.
| Compound Name | N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 46739747 |
| Molecular Formula | C18H22BNO3 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| SMILES | CC1(C)OB(c2ccc(/C=N/Cc3ccco3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H22BNO3/c1-17(2)18(3,4)23-19(22-17)15-9-7-14(8-10-15)12-20-13-16-6-5-11-21-16/h5-12H,13H2,1-4H3/b20-12+ |
| InChIKey | IIAOBOBJQMILAT-UDWIEESQSA-N |
| XLogP | 3.20 |
| TPSA | 43.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|