C13H23N3 — CID 46742334
2-[(3R,5S)-3,5-dimethyl-1-adamantyl]guanidine (PubChem CID 46742334) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-[(3R,5S)-3,5-dimethyl-1-adamantyl]guanidine.
| Compound Name | 2-[(3R,5S)-3,5-dimethyl-1-adamantyl]guanidine |
|---|---|
| PubChem CID | 46742334 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-[(3R,5S)-3,5-dimethyl-1-adamantyl]guanidine |
| SMILES | C[C@]12CC3CC(N=C(N)N)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C13H23N3/c1-11-3-9-4-12(2,6-11)8-13(5-9,7-11)16-10(14)15/h9H,3-8H2,1-2H3,(H4,14,15,16)/t9?,11-,12+,13? |
| InChIKey | BPAJVQXJSNNFEJ-QGVZIFMBSA-N |
| XLogP | 2.01 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|