C27H25NO6 — CID 4675484
2-(4-ethoxyphenoxy)ethyl 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4675484) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4675484 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCOc1ccc(OCCOC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)ccc2C)C3=O)cc1 |
| InChI | InChI=1S/C27H25NO6/c1-4-32-20-8-10-21(11-9-20)33-13-14-34-27(31)19-7-12-22-23(16-19)26(30)28(25(22)29)24-15-17(2)5-6-18(24)3/h5-12,15-16H,4,13-14H2,1-3H3 |
| InChIKey | GJDVRYUAFGMKOO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|