C25H22N6O5S2 — CID 4675715
2-cyano-2-[5-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 4675715) has the molecular formula C25H22N6O5S2 and a molecular weight of 550.62 g/mol. Its IUPAC name is 2-cyano-2-[5-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-cyano-2-[5-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4675715 |
| Molecular Formula | C25H22N6O5S2 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 2-cyano-2-[5-[(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | C=CCn1c(=C(C#N)C(=O)NCC2CCCO2)sc(=Cc2ccc(Sc3ncccn3)c([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C25H22N6O5S2/c1-2-10-30-23(33)21(37-24(30)18(14-26)22(32)29-15-17-5-3-11-36-17)13-16-6-7-20(19(12-16)31(34)35)38-25-27-8-4-9-28-25/h2,4,6-9,12-13,17H,1,3,5,10-11,15H2,(H,29,32) |
| InChIKey | WHFTTZBYUPMORP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|