C28H32N2O3 — CID 46763392
4-tert-butyl-N-[3-[[2-(2,3,5-trimethylphenoxy)acetyl]amino]phenyl]benzamide (PubChem CID 46763392) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[[2-(2,3,5-trimethylphenoxy)acetyl]amino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[[2-(2,3,5-trimethylphenoxy)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 46763392 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-tert-butyl-N-[3-[[2-(2,3,5-trimethylphenoxy)acetyl]amino]phenyl]benzamide |
| SMILES | Cc1cc(C)c(C)c(OCC(=O)Nc2cccc(NC(=O)c3ccc(C(C)(C)C)cc3)c2)c1 |
| InChI | InChI=1S/C28H32N2O3/c1-18-14-19(2)20(3)25(15-18)33-17-26(31)29-23-8-7-9-24(16-23)30-27(32)21-10-12-22(13-11-21)28(4,5)6/h7-16H,17H2,1-6H3,(H,29,31)(H,30,32) |
| InChIKey | QZWSRRLFPKCGRX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |