C24H21N5O5S2 — CID 46764391
4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 46764391) has the molecular formula C24H21N5O5S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is 4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 46764391 |
| Molecular Formula | C24H21N5O5S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | O=C(CCCN1c2cccc3cccc(c23)S1(=O)=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C24H21N5O5S2/c30-22(27-18-10-12-19(13-11-18)35(31,32)28-24-25-14-4-15-26-24)9-3-16-29-20-7-1-5-17-6-2-8-21(23(17)20)36(29,33)34/h1-2,4-8,10-15H,3,9,16H2,(H,27,30)(H,25,26,28) |
| InChIKey | GFUVJNNWFJSUIZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |