C22H21FN2O3S — CID 94027812
4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(1S)-1-(4-fluorophenyl)ethyl]butanamide (PubChem CID 94027812) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(1S)-1-(4-fluorophenyl)ethyl]butanamide.
| Compound Name | 4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(1S)-1-(4-fluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 94027812 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)-N-[(1S)-1-(4-fluorophenyl)ethyl]butanamide |
| SMILES | C[C@H](NC(=O)CCCN1c2cccc3cccc(c23)S1(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O3S/c1-15(16-10-12-18(23)13-11-16)24-21(26)9-4-14-25-19-7-2-5-17-6-3-8-20(22(17)19)29(25,27)28/h2-3,5-8,10-13,15H,4,9,14H2,1H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | KXGPQSSZCGFXBA-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |