C25H33ClN2O2 — CID 46765175
1-[(3-chlorophenyl)methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide (PubChem CID 46765175) has the molecular formula C25H33ClN2O2 and a molecular weight of 429.00 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46765175 |
| Molecular Formula | C25H33ClN2O2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide |
| SMILES | CCCOc1ccccc1CCCNC(=O)C1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H33ClN2O2/c1-2-17-30-24-11-4-3-8-21(24)9-6-14-27-25(29)22-12-15-28(16-13-22)19-20-7-5-10-23(26)18-20/h3-5,7-8,10-11,18,22H,2,6,9,12-17,19H2,1H3,(H,27,29) |
| InChIKey | IPICGXUJJYDMEX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|