C31H42N4O3 — CID 38145232
1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide (PubChem CID 38145232) has the molecular formula C31H42N4O3 and a molecular weight of 518.70 g/mol. Its IUPAC name is 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38145232 |
| Molecular Formula | C31H42N4O3 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(2-propoxyphenyl)propyl]piperidine-4-carboxamide |
| SMILES | CCCOc1ccccc1CCCNC(=O)C1CCN(Cc2nc(-c3ccc(C(C)(C)C)cc3)no2)CC1 |
| InChI | InChI=1S/C31H42N4O3/c1-5-21-37-27-11-7-6-9-23(27)10-8-18-32-30(36)25-16-19-35(20-17-25)22-28-33-29(34-38-28)24-12-14-26(15-13-24)31(2,3)4/h6-7,9,11-15,25H,5,8,10,16-22H2,1-4H3,(H,32,36) |
| InChIKey | SQNMWTLBGMVOHR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|