C22H28ClN3O3S — CID 46767585
2-(2-chloro-N-methylsulfonylanilino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 46767585) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is 2-(2-chloro-N-methylsulfonylanilino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2-chloro-N-methylsulfonylanilino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 46767585 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-(2-chloro-N-methylsulfonylanilino)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCc1ccc(CN2CCCCC2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H28ClN3O3S/c1-30(28,29)26(21-8-4-3-7-20(21)23)17-22(27)24-15-18-9-11-19(12-10-18)16-25-13-5-2-6-14-25/h3-4,7-12H,2,5-6,13-17H2,1H3,(H,24,27) |
| InChIKey | XQRJHSBBQZEWND-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |