C26H29N3O6S2 — CID 46771335
2-[benzyl(methylsulfonyl)amino]-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 46771335) has the molecular formula C26H29N3O6S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-[benzyl(methylsulfonyl)amino]-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-[benzyl(methylsulfonyl)amino]-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 46771335 |
| Molecular Formula | C26H29N3O6S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 2-[benzyl(methylsulfonyl)amino]-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1NC(=O)c1ccccc1N(Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H29N3O6S2/c1-35-25-15-14-21(37(33,34)28-16-8-9-17-28)18-23(25)27-26(30)22-12-6-7-13-24(22)29(36(2,31)32)19-20-10-4-3-5-11-20/h3-7,10-15,18H,8-9,16-17,19H2,1-2H3,(H,27,30) |
| InChIKey | UJLNIVCLFAZNDU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |