C28H24ClN3O3S — CID 46772876
2-chloro-N-(9-ethylcarbazol-3-yl)-5-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 46772876) has the molecular formula C28H24ClN3O3S and a molecular weight of 518.04 g/mol. Its IUPAC name is 2-chloro-N-(9-ethylcarbazol-3-yl)-5-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | 2-chloro-N-(9-ethylcarbazol-3-yl)-5-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 46772876 |
| Molecular Formula | C28H24ClN3O3S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 2-chloro-N-(9-ethylcarbazol-3-yl)-5-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)c3cc(NS(=O)(=O)c4ccc(C)cc4)ccc3Cl)ccc21 |
| InChI | InChI=1S/C28H24ClN3O3S/c1-3-32-26-7-5-4-6-22(26)23-16-19(11-15-27(23)32)30-28(33)24-17-20(10-14-25(24)29)31-36(34,35)21-12-8-18(2)9-13-21/h4-17,31H,3H2,1-2H3,(H,30,33) |
| InChIKey | LEMKFOATYQUBNQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |