C24H28ClNO3 — CID 4677808
(4a-chloro-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 4677808) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (4a-chloro-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (4a-chloro-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 4677808 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (4a-chloro-1-phenyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC3(Cl)CCCCC3C2c2ccccc2)c1 |
| InChI | InChI=1S/C24H28ClNO3/c1-28-19-14-18(15-20(16-19)29-2)23(27)26-13-12-24(25)11-7-6-10-21(24)22(26)17-8-4-3-5-9-17/h3-5,8-9,14-16,21-22H,6-7,10-13H2,1-2H3 |
| InChIKey | HLWRCSWXRBUKBS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|