C21H25NO3S — CID 7613683
[(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-thiophen-2-ylmethanone (PubChem CID 7613683) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is [(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-thiophen-2-ylmethanone.
| Compound Name | [(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 7613683 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-thiophen-2-ylmethanone |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@]3(O)CCN2C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H25NO3S/c1-25-16-9-7-15(8-10-16)19-17-5-2-3-11-21(17,24)12-13-22(19)20(23)18-6-4-14-26-18/h4,6-10,14,17,19,24H,2-3,5,11-13H2,1H3/t17-,19-,21-/m0/s1 |
| InChIKey | JOVMGMZFXVTCIX-CUWPLCDZSA-N |
| XLogP | 4.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |