C27H26N6O8S2 — CID 46778322
2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 46778322) has the molecular formula C27H26N6O8S2 and a molecular weight of 626.67 g/mol. Its IUPAC name is 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46778322 |
| Molecular Formula | C27H26N6O8S2 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H26N6O8S2/c1-18-4-11-24(16-25(18)33(35)36)43(39,40)32(21-7-9-22(41-3)10-8-21)17-26(34)30-20-5-12-23(13-6-20)42(37,38)31-27-28-15-14-19(2)29-27/h4-16H,17H2,1-3H3,(H,30,34)(H,28,29,31) |
| InChIKey | HUVAAJDSEIMIOP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|