C27H29N3O7S — CID 43896585
N-(4-cyclopentyloxyphenyl)-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 43896585) has the molecular formula C27H29N3O7S and a molecular weight of 539.61 g/mol. Its IUPAC name is N-(4-cyclopentyloxyphenyl)-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(4-cyclopentyloxyphenyl)-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43896585 |
| Molecular Formula | C27H29N3O7S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-(4-cyclopentyloxyphenyl)-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccc(OC3CCCC3)cc2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H29N3O7S/c1-19-7-16-25(17-26(19)30(32)33)38(34,35)29(21-10-14-22(36-2)15-11-21)18-27(31)28-20-8-12-24(13-9-20)37-23-5-3-4-6-23/h7-17,23H,3-6,18H2,1-2H3,(H,28,31) |
| InChIKey | PBCIKSWQFRQGAY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|