C23H27N3O6S — CID 98183455
N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 98183455) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 98183455 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N[C@@H]2C[C@H]3CC[C@H]2C3)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H27N3O6S/c1-15-3-10-20(13-22(15)26(28)29)33(30,31)25(18-6-8-19(32-2)9-7-18)14-23(27)24-21-12-16-4-5-17(21)11-16/h3,6-10,13,16-17,21H,4-5,11-12,14H2,1-2H3,(H,24,27)/t16-,17-,21+/m0/s1 |
| InChIKey | YIXYHEGQMKAEQE-XGHQBKJUSA-N |
| XLogP | 3.41 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|