C26H26N4O7S2 — CID 100551860
2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-oxo-3-propan-2-yl-1,3-benzothiazol-6-yl)acetamide (PubChem CID 100551860) has the molecular formula C26H26N4O7S2 and a molecular weight of 570.65 g/mol. Its IUPAC name is 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-oxo-3-propan-2-yl-1,3-benzothiazol-6-yl)acetamide.
| Compound Name | 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-oxo-3-propan-2-yl-1,3-benzothiazol-6-yl)acetamide |
|---|---|
| PubChem CID | 100551860 |
| Molecular Formula | C26H26N4O7S2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-oxo-3-propan-2-yl-1,3-benzothiazol-6-yl)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccc3c(c2)sc(=O)n3C(C)C)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H26N4O7S2/c1-16(2)29-22-12-6-18(13-24(22)38-26(29)32)27-25(31)15-28(19-7-9-20(37-4)10-8-19)39(35,36)21-11-5-17(3)23(14-21)30(33)34/h5-14,16H,15H2,1-4H3,(H,27,31) |
| InChIKey | UZZLGCRVRHAUAU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|