C14H8Cl4O2 — CID 46779756
5-chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride (PubChem CID 46779756) has the molecular formula C14H8Cl4O2 and a molecular weight of 350.03 g/mol. Its IUPAC name is 5-chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride.
| Compound Name | 5-chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride |
|---|---|
| PubChem CID | 46779756 |
| Molecular Formula | C14H8Cl4O2 |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 5-chloro-2-[(3,4-dichlorophenyl)methoxy]benzoyl chloride |
| SMILES | O=C(Cl)c1cc(Cl)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl4O2/c15-9-2-4-13(10(6-9)14(18)19)20-7-8-1-3-11(16)12(17)5-8/h1-6H,7H2 |
| InChIKey | ORTLYGUSUPFWIL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|