C20H24N2O2 — CID 46781402
N,N'-bis(2,3,4,5,6-pentadeuteriophenyl)octanediamide (PubChem CID 46781402) has the molecular formula C20H24N2O2 and a molecular weight of 334.49 g/mol. Its IUPAC name is N,N'-bis(2,3,4,5,6-pentadeuteriophenyl)octanediamide.
| Compound Name | N,N'-bis(2,3,4,5,6-pentadeuteriophenyl)octanediamide |
|---|---|
| PubChem CID | 46781402 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | N,N'-bis(2,3,4,5,6-pentadeuteriophenyl)octanediamide |
| SMILES | [2H]c1c([2H])c([2H])c(NC(=O)CCCCCCC(=O)Nc2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C20H24N2O2/c23-19(21-17-11-5-3-6-12-17)15-9-1-2-10-16-20(24)22-18-13-7-4-8-14-18/h3-8,11-14H,1-2,9-10,15-16H2,(H,21,23)(H,22,24)/i3D,4D,5D,6D,7D,8D,11D,12D,13D,14D |
| InChIKey | QOSWSNDWUATJBJ-QQJQIFQQSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|