C21H29N3O6 — CID 46791737
[2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate (PubChem CID 46791737) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate.
| Compound Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46791737 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]acetate |
| SMILES | CCOc1ccc(C(=O)NCC(=O)OCC(=O)NC(=O)NC2CCCCC2C)cc1 |
| InChI | InChI=1S/C21H29N3O6/c1-3-29-16-10-8-15(9-11-16)20(27)22-12-19(26)30-13-18(25)24-21(28)23-17-7-5-4-6-14(17)2/h8-11,14,17H,3-7,12-13H2,1-2H3,(H,22,27)(H2,23,24,25,28) |
| InChIKey | RCPJTCFODJUNJD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |