C23H24N2O5S — CID 46794226
[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-(ethylsulfamoyl)-2-methylbenzoate (PubChem CID 46794226) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-(ethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-(ethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 46794226 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 5-(ethylsulfamoyl)-2-methylbenzoate |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)OC(C)C(=O)Nc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C23H24N2O5S/c1-4-24-31(28,29)20-12-9-15(2)21(14-20)23(27)30-16(3)22(26)25-19-11-10-17-7-5-6-8-18(17)13-19/h5-14,16,24H,4H2,1-3H3,(H,25,26) |
| InChIKey | QFXWETONFAGVHX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |