C25H22N2O5S2 — CID 55368168
[1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate (PubChem CID 55368168) has the molecular formula C25H22N2O5S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55368168 |
| Molecular Formula | C25H22N2O5S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H22N2O5S2/c1-17(24(28)27-21-12-11-18-6-2-3-7-19(18)14-21)32-25(29)20-8-4-10-23(15-20)34(30,31)26-16-22-9-5-13-33-22/h2-15,17,26H,16H2,1H3,(H,27,28) |
| InChIKey | LABMSCKXIKCLPB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |