C23H24N2O5S2 — CID 55481325
[2-oxo-2-(3-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate (PubChem CID 55481325) has the molecular formula C23H24N2O5S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is [2-oxo-2-(3-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(3-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55481325 |
| Molecular Formula | C23H24N2O5S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | [2-oxo-2-(3-propan-2-ylanilino)ethyl] 3-(thiophen-2-ylmethylsulfamoyl)benzoate |
| SMILES | CC(C)c1cccc(NC(=O)COC(=O)c2cccc(S(=O)(=O)NCc3cccs3)c2)c1 |
| InChI | InChI=1S/C23H24N2O5S2/c1-16(2)17-6-3-8-19(12-17)25-22(26)15-30-23(27)18-7-4-10-21(13-18)32(28,29)24-14-20-9-5-11-31-20/h3-13,16,24H,14-15H2,1-2H3,(H,25,26) |
| InChIKey | HPGBCPZWROJSKP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |