C21H16N2O6S2 — CID 41451176
(1,3-dioxoisoindol-2-yl)methyl 3-(thiophen-2-ylmethylsulfamoyl)benzoate (PubChem CID 41451176) has the molecular formula C21H16N2O6S2 and a molecular weight of 456.50 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-(thiophen-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-(thiophen-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 41451176 |
| Molecular Formula | C21H16N2O6S2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-(thiophen-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cccc(S(=O)(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C21H16N2O6S2/c24-19-17-8-1-2-9-18(17)20(25)23(19)13-29-21(26)14-5-3-7-16(11-14)31(27,28)22-12-15-6-4-10-30-15/h1-11,22H,12-13H2 |
| InChIKey | ZSCPBEWANCVCAM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|