C27H30N4O4 — CID 46795314
[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate (PubChem CID 46795314) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 46795314 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 4-oxo-3-pentylphthalazine-1-carboxylate |
| SMILES | CCCCCn1nc(C(=O)OCC(=O)N(CCC#N)c2cc(C)cc(C)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C27H30N4O4/c1-4-5-8-14-31-26(33)23-11-7-6-10-22(23)25(29-31)27(34)35-18-24(32)30(13-9-12-28)21-16-19(2)15-20(3)17-21/h6-7,10-11,15-17H,4-5,8-9,13-14,18H2,1-3H3 |
| InChIKey | PPSSIISRZOSIIR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|