C19H22IN3O3S — CID 46797699
1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-iodo-2-methylanilino)ethanone (PubChem CID 46797699) has the molecular formula C19H22IN3O3S and a molecular weight of 499.37 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-iodo-2-methylanilino)ethanone.
| Compound Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-iodo-2-methylanilino)ethanone |
|---|---|
| PubChem CID | 46797699 |
| Molecular Formula | C19H22IN3O3S |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 1-[4-(benzenesulfonyl)piperazin-1-yl]-2-(4-iodo-2-methylanilino)ethanone |
| SMILES | Cc1cc(I)ccc1NCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22IN3O3S/c1-15-13-16(20)7-8-18(15)21-14-19(24)22-9-11-23(12-10-22)27(25,26)17-5-3-2-4-6-17/h2-8,13,21H,9-12,14H2,1H3 |
| InChIKey | MKYLSHINKZQEAJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|