C13H10BrF2NO2S — CID 46800107
N-(4-bromo-2-methylphenyl)-3,5-difluorobenzenesulfonamide (PubChem CID 46800107) has the molecular formula C13H10BrF2NO2S and a molecular weight of 362.20 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3,5-difluorobenzenesulfonamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 46800107 |
| Molecular Formula | C13H10BrF2NO2S |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3,5-difluorobenzenesulfonamide |
| SMILES | Cc1cc(Br)ccc1NS(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H10BrF2NO2S/c1-8-4-9(14)2-3-13(8)17-20(18,19)12-6-10(15)5-11(16)7-12/h2-7,17H,1H3 |
| InChIKey | JNYIKJNUVTYQFQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |