C25H28N4O2S2 — CID 46806194
3-(3-methylbutyl)-2-[(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 46806194) has the molecular formula C25H28N4O2S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 3-(3-methylbutyl)-2-[(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-methylbutyl)-2-[(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46806194 |
| Molecular Formula | C25H28N4O2S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 3-(3-methylbutyl)-2-[(6-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methylsulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cccc2nc(CSc3nc4sc5c(c4c(=O)n3CCC(C)C)CCCC5)cc(=O)n12 |
| InChI | InChI=1S/C25H28N4O2S2/c1-15(2)11-12-28-24(31)22-18-8-4-5-9-19(18)33-23(22)27-25(28)32-14-17-13-21(30)29-16(3)7-6-10-20(29)26-17/h6-7,10,13,15H,4-5,8-9,11-12,14H2,1-3H3 |
| InChIKey | UUIAUUYJOONQAE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |