C20H24ClN5O4S — CID 46806460
2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 46806460) has the molecular formula C20H24ClN5O4S and a molecular weight of 465.96 g/mol. Its IUPAC name is 2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | 2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 46806460 |
| Molecular Formula | C20H24ClN5O4S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[5-chloro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanyl-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | COCCn1c(SCC(=O)NN2C(=O)NC3(CCCCC3)C2=O)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H24ClN5O4S/c1-30-10-9-25-15-6-5-13(21)11-14(15)22-19(25)31-12-16(27)24-26-17(28)20(23-18(26)29)7-3-2-4-8-20/h5-6,11H,2-4,7-10,12H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | JLKVWBYSSNPTDZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|