C22H28N2O5S — CID 46811420
[2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-(butan-2-ylsulfamoyl)benzoate (PubChem CID 46811420) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-(butan-2-ylsulfamoyl)benzoate.
| Compound Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-(butan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46811420 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 4-(butan-2-ylsulfamoyl)benzoate |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)OCC(=O)N(C)C(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N2O5S/c1-5-16(2)23-30(27,28)20-13-11-19(12-14-20)22(26)29-15-21(25)24(4)17(3)18-9-7-6-8-10-18/h6-14,16-17,23H,5,15H2,1-4H3 |
| InChIKey | MVGONSPUTBJSAP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |